C28H31N3O4S — CID 17134798
N-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide (PubChem CID 17134798) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is N-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide.
| Compound Name | N-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17134798 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide |
| SMILES | CCC(C)c1ccccc1OCC(=O)NNC(=S)NC(=O)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C28H31N3O4S/c1-3-20(2)24-14-7-8-15-25(24)35-19-26(32)30-31-28(36)29-27(33)22-12-9-13-23(18-22)34-17-16-21-10-5-4-6-11-21/h4-15,18,20H,3,16-17,19H2,1-2H3,(H,30,32)(H2,29,31,33,36) |
| InChIKey | XHTKWVIBZJEDDB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|