C19H18ClFN2O5 — CID 9318757
[2-(2-methoxyethylamino)-2-oxoethyl] 4-chloro-2-[(4-fluorobenzoyl)amino]benzoate (PubChem CID 9318757) has the molecular formula C19H18ClFN2O5 and a molecular weight of 408.81 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 4-chloro-2-[(4-fluorobenzoyl)amino]benzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-chloro-2-[(4-fluorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 9318757 |
| Molecular Formula | C19H18ClFN2O5 |
| Molecular Weight | 408.81 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-chloro-2-[(4-fluorobenzoyl)amino]benzoate |
| SMILES | COCCNC(=O)COC(=O)c1ccc(Cl)cc1NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18ClFN2O5/c1-27-9-8-22-17(24)11-28-19(26)15-7-4-13(20)10-16(15)23-18(25)12-2-5-14(21)6-3-12/h2-7,10H,8-9,11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | PABYEVOKBHUPEZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.81 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|