C18H18FNO4 — CID 8581743
[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] 2-hydroxy-4-methylbenzoate (PubChem CID 8581743) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] 2-hydroxy-4-methylbenzoate.
| Compound Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 8581743 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NCCc2ccccc2F)c(O)c1 |
| InChI | InChI=1S/C18H18FNO4/c1-12-6-7-14(16(21)10-12)18(23)24-11-17(22)20-9-8-13-4-2-3-5-15(13)19/h2-7,10,21H,8-9,11H2,1H3,(H,20,22) |
| InChIKey | RJGYQGSRSVRJGZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |