C13H18F2N4O — CID 120663306
2-[[amino-(3,4-dimethylanilino)methylidene]amino]-N-(2,2-difluoroethyl)acetamide (PubChem CID 120663306) has the molecular formula C13H18F2N4O and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-[[amino-(3,4-dimethylanilino)methylidene]amino]-N-(2,2-difluoroethyl)acetamide.
| Compound Name | 2-[[amino-(3,4-dimethylanilino)methylidene]amino]-N-(2,2-difluoroethyl)acetamide |
|---|---|
| PubChem CID | 120663306 |
| Molecular Formula | C13H18F2N4O |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[[amino-(3,4-dimethylanilino)methylidene]amino]-N-(2,2-difluoroethyl)acetamide |
| SMILES | Cc1ccc(N/C(N)=N/CC(=O)NCC(F)F)cc1C |
| InChI | InChI=1S/C13H18F2N4O/c1-8-3-4-10(5-9(8)2)19-13(16)18-7-12(20)17-6-11(14)15/h3-5,11H,6-7H2,1-2H3,(H,17,20)(H3,16,18,19) |
| InChIKey | ZUWKDWJPBJJWFT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|