C15H20F2N4O — CID 120663334
2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-N-(2,2-difluoroethyl)acetamide (PubChem CID 120663334) has the molecular formula C15H20F2N4O and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-N-(2,2-difluoroethyl)acetamide.
| Compound Name | 2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-N-(2,2-difluoroethyl)acetamide |
|---|---|
| PubChem CID | 120663334 |
| Molecular Formula | C15H20F2N4O |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-N-(2,2-difluoroethyl)acetamide |
| SMILES | N/C(=N\CC(=O)NCC(F)F)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C15H20F2N4O/c16-13(17)8-19-14(22)9-20-15(18)21-12-7-3-5-10-4-1-2-6-11(10)12/h3,5,7,13H,1-2,4,6,8-9H2,(H,19,22)(H3,18,20,21) |
| InChIKey | RYUXWLXSGKLBQY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|