C20H30N4O — CID 119142469
2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-N-cyclohexyl-N-methylacetamide (PubChem CID 119142469) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 119142469 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-N-cyclohexyl-N-methylacetamide |
| SMILES | CN(C(=O)C/N=C(\N)Nc1cccc2c1CCCC2)C1CCCCC1 |
| InChI | InChI=1S/C20H30N4O/c1-24(16-10-3-2-4-11-16)19(25)14-22-20(21)23-18-13-7-9-15-8-5-6-12-17(15)18/h7,9,13,16H,2-6,8,10-12,14H2,1H3,(H3,21,22,23) |
| InChIKey | XQNYYVWBGHKEOA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|