C15H21IN4O2S2 — CID 119942640
1-(3-methylphenyl)-2-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]guanidine;hydroiodide (PubChem CID 119942640) has the molecular formula C15H21IN4O2S2 and a molecular weight of 480.40 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methylphenyl)-2-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119942640 |
| Molecular Formula | C15H21IN4O2S2 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 1-(3-methylphenyl)-2-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]guanidine;hydroiodide |
| SMILES | Cc1cccc(N/C(N)=N/CCN(C)S(=O)(=O)c2cccs2)c1.I |
| InChI | InChI=1S/C15H20N4O2S2.HI/c1-12-5-3-6-13(11-12)18-15(16)17-8-9-19(2)23(20,21)14-7-4-10-22-14;/h3-7,10-11H,8-9H2,1-2H3,(H3,16,17,18);1H |
| InChIKey | KZERZKWJVMZDEL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|