C12H23IN4O2S2 — CID 86780372
1,3-diethyl-2-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]guanidine;hydroiodide (PubChem CID 86780372) has the molecular formula C12H23IN4O2S2 and a molecular weight of 446.38 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1,3-diethyl-2-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 86780372 |
| Molecular Formula | C12H23IN4O2S2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 1,3-diethyl-2-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCNC(=NCCN(C)S(=O)(=O)c1cccs1)NCC.I |
| InChI | InChI=1S/C12H22N4O2S2.HI/c1-4-13-12(14-5-2)15-8-9-16(3)20(17,18)11-7-6-10-19-11;/h6-7,10H,4-5,8-9H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | QJPWQNXJGJIGLX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|