C13H18F3N3O — CID 111057658
1-(3-methylphenyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111057658) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-(3-methylphenyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111057658 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(3-methylphenyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | Cc1cccc(N/C(N)=N/CCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3N3O/c1-10-4-2-5-11(8-10)19-12(17)18-6-3-7-20-9-13(14,15)16/h2,4-5,8H,3,6-7,9H2,1H3,(H3,17,18,19) |
| InChIKey | QINIKPXKYQMHGJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|