C14H22IN3O4 — CID 111097462
methyl 3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]-2-methylpropanoate;hydroiodide (PubChem CID 111097462) has the molecular formula C14H22IN3O4 and a molecular weight of 423.25 g/mol. Its IUPAC name is methyl 3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 111097462 |
| Molecular Formula | C14H22IN3O4 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | methyl 3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]-2-methylpropanoate;hydroiodide |
| SMILES | COC(=O)C(C)C/N=C(\N)Nc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C14H21N3O4.HI/c1-9(13(18)21-4)8-16-14(15)17-10-5-6-11(19-2)12(7-10)20-3;/h5-7,9H,8H2,1-4H3,(H3,15,16,17);1H |
| InChIKey | MXHGYCFLFXTPBJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|