C36H36O7S2 — CID 90840479
[4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-(4-methylphenyl)methanone;ethane;methanesulfonic acid (PubChem CID 90840479) has the molecular formula C36H36O7S2 and a molecular weight of 644.81 g/mol. Its IUPAC name is [4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-(4-methylphenyl)methanone;ethane;methanesulfonic acid.
| Compound Name | [4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-(4-methylphenyl)methanone;ethane;methanesulfonic acid |
|---|---|
| PubChem CID | 90840479 |
| Molecular Formula | C36H36O7S2 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.19 |
| IUPAC Name | [4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-(4-methylphenyl)methanone;ethane;methanesulfonic acid |
| SMILES | CC.CS(=O)(=O)O.Cc1ccc(C(=O)c2ccc(Oc3ccc(S(=O)(=O)c4ccc(Cc5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H26O4S.C2H6.CH4O3S/c1-24-7-11-27(12-8-24)33(34)28-13-15-29(16-14-28)37-30-17-21-32(22-18-30)38(35,36)31-19-9-26(10-20-31)23-25-5-3-2-4-6-25;1-2;1-5(2,3)4/h2-22H,23H2,1H3;1-2H3;1H3,(H,2,3,4) |
| InChIKey | FPMRIQQTVSYPQY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|