About perylene diisocyanate
perylene diisocyanate (PubChem CID 21242736) has the molecular formula C22H12N2O2-2
and a molecular weight of 336.35 g/mol. Its IUPAC name is perylene diisocyanate.
Molecular Properties
| Compound Name | perylene diisocyanate |
| PubChem CID | 21242736 |
| Molecular Formula | C22H12N2O2-2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | perylene diisocyanate |
| SMILES | [N-]=C=O.[N-]=C=O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.2CNO/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;2*2-1-3/h1-12H;;/q;2*-1 |
| InChIKey | WREBBWBHVZXBOE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze perylene diisocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perylene diisocyanate?
The IUPAC name of perylene diisocyanate (CID 21242736) is perylene diisocyanate.
What is the SMILES notation for perylene diisocyanate?
The canonical SMILES for perylene diisocyanate is [N-]=C=O.[N-]=C=O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of perylene diisocyanate?
The InChIKey is WREBBWBHVZXBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.2CNO/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;2*2-1-3/h1-12H;;/q;2*-1.
What are the key properties of perylene diisocyanate?
perylene diisocyanate has a molecular weight of 336.35 g/mol, XLogP of 5.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for perylene diisocyanate is sourced from PubChem (CID 21242736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).