C24H14O3 — CID 159629653
furan-2,5-dione;perylene (PubChem CID 159629653) has the molecular formula C24H14O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is furan-2,5-dione;perylene.
| Compound Name | furan-2,5-dione;perylene |
|---|---|
| PubChem CID | 159629653 |
| Molecular Formula | C24H14O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | furan-2,5-dione;perylene |
| SMILES | O=C1C=CC(=O)O1.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C4H2O3/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;5-3-1-2-4(6)7-3/h1-12H;1-2H |
| InChIKey | MOYMBSIQKXAIKC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|