C14H11NS2 — CID 116889519
(2-naphthalen-1-yl-1,3-thiazol-4-yl)methanethiol (PubChem CID 116889519) has the molecular formula C14H11NS2 and a molecular weight of 257.38 g/mol. Its IUPAC name is (2-naphthalen-1-yl-1,3-thiazol-4-yl)methanethiol.
| Compound Name | (2-naphthalen-1-yl-1,3-thiazol-4-yl)methanethiol |
|---|---|
| PubChem CID | 116889519 |
| Molecular Formula | C14H11NS2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | (2-naphthalen-1-yl-1,3-thiazol-4-yl)methanethiol |
| SMILES | SCc1csc(-c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C14H11NS2/c16-8-11-9-17-14(15-11)13-7-3-5-10-4-1-2-6-12(10)13/h1-7,9,16H,8H2 |
| InChIKey | HXDUIAGGIDGREW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|