About 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine
3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine (PubChem CID 70282133) has the molecular formula C8H13N3S2
and a molecular weight of 215.35 g/mol. Its IUPAC name is 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine.
Molecular Properties
| Compound Name | 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine |
| PubChem CID | 70282133 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine |
| SMILES | NCC=CSCc1csc(CN)n1 |
| InChI | InChI=1S/C8H13N3S2/c9-2-1-3-12-5-7-6-13-8(4-10)11-7/h1,3,6H,2,4-5,9-10H2 |
| InChIKey | YGQRAIXZESNRBJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine?
The IUPAC name of 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine (CID 70282133) is 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine.
What is the SMILES notation for 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine?
The canonical SMILES for 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine is NCC=CSCc1csc(CN)n1.
What is the InChIKey of 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine?
The InChIKey is YGQRAIXZESNRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S2/c9-2-1-3-12-5-7-6-13-8(4-10)11-7/h1,3,6H,2,4-5,9-10H2.
What are the key properties of 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine?
3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine has a molecular weight of 215.35 g/mol, XLogP of 1.31, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]prop-2-en-1-amine is sourced from PubChem (CID 70282133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).