C15H21NS — CID 129076363
4-(4-cyclohexa-1,3-dien-1-ylbutyl)-2-ethyl-1,3-thiazole (PubChem CID 129076363) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 4-(4-cyclohexa-1,3-dien-1-ylbutyl)-2-ethyl-1,3-thiazole.
| Compound Name | 4-(4-cyclohexa-1,3-dien-1-ylbutyl)-2-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 129076363 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4-(4-cyclohexa-1,3-dien-1-ylbutyl)-2-ethyl-1,3-thiazole |
| SMILES | CCc1nc(CCCCC2=CC=CCC2)cs1 |
| InChI | InChI=1S/C15H21NS/c1-2-15-16-14(12-17-15)11-7-6-10-13-8-4-3-5-9-13/h3-4,8,12H,2,5-7,9-11H2,1H3 |
| InChIKey | SKEUBUSXOYCOPM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|