C10H14F3NOS — CID 104932543
4-tert-butyl-2-(2,2,2-trifluoroethoxymethyl)-1,3-thiazole (PubChem CID 104932543) has the molecular formula C10H14F3NOS and a molecular weight of 253.29 g/mol. Its IUPAC name is 4-tert-butyl-2-(2,2,2-trifluoroethoxymethyl)-1,3-thiazole.
| Compound Name | 4-tert-butyl-2-(2,2,2-trifluoroethoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 104932543 |
| Molecular Formula | C10H14F3NOS |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 4-tert-butyl-2-(2,2,2-trifluoroethoxymethyl)-1,3-thiazole |
| SMILES | CC(C)(C)c1csc(COCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H14F3NOS/c1-9(2,3)7-5-16-8(14-7)4-15-6-10(11,12)13/h5H,4,6H2,1-3H3 |
| InChIKey | CXVOFVJYWIKLBI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |