C12H16F3NO — CID 20709426
2-tert-butyl-6-(2,2,2-trifluoroethoxymethyl)pyridine (PubChem CID 20709426) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-tert-butyl-6-(2,2,2-trifluoroethoxymethyl)pyridine.
| Compound Name | 2-tert-butyl-6-(2,2,2-trifluoroethoxymethyl)pyridine |
|---|---|
| PubChem CID | 20709426 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-tert-butyl-6-(2,2,2-trifluoroethoxymethyl)pyridine |
| SMILES | CC(C)(C)c1cccc(COCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H16F3NO/c1-11(2,3)10-6-4-5-9(16-10)7-17-8-12(13,14)15/h4-6H,7-8H2,1-3H3 |
| InChIKey | AZEPEZWDDHSFIV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |