C13H15BrN2OS — CID 103816184
2-[(6-bromo-3-pyridinyl)oxymethyl]-4-tert-butyl-1,3-thiazole (PubChem CID 103816184) has the molecular formula C13H15BrN2OS and a molecular weight of 327.25 g/mol. Its IUPAC name is 2-[(6-bromo-3-pyridinyl)oxymethyl]-4-tert-butyl-1,3-thiazole.
| Compound Name | 2-[(6-bromo-3-pyridinyl)oxymethyl]-4-tert-butyl-1,3-thiazole |
|---|---|
| PubChem CID | 103816184 |
| Molecular Formula | C13H15BrN2OS |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2-[(6-bromo-3-pyridinyl)oxymethyl]-4-tert-butyl-1,3-thiazole |
| SMILES | CC(C)(C)c1csc(COc2ccc(Br)nc2)n1 |
| InChI | InChI=1S/C13H15BrN2OS/c1-13(2,3)10-8-18-12(16-10)7-17-9-4-5-11(14)15-6-9/h4-6,8H,7H2,1-3H3 |
| InChIKey | PVWVDOQQGUUMBI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|