About ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate
ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate (PubChem CID 171446396) has the molecular formula C11H11F2NO2
and a molecular weight of 227.21 g/mol. Its IUPAC name is ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate |
| PubChem CID | 171446396 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc2c1CC(F)(F)C2 |
| InChI | InChI=1S/C11H11F2NO2/c1-2-16-10(15)7-3-4-14-9-6-11(12,13)5-8(7)9/h3-4H,2,5-6H2,1H3 |
| InChIKey | HZYFFLUDLXGXMZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate?
The IUPAC name of ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate (CID 171446396) is ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate.
What is the SMILES notation for ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate?
The canonical SMILES for ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate is CCOC(=O)c1ccnc2c1CC(F)(F)C2.
What is the InChIKey of ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate?
The InChIKey is HZYFFLUDLXGXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO2/c1-2-16-10(15)7-3-4-14-9-6-11(12,13)5-8(7)9/h3-4H,2,5-6H2,1H3.
What are the key properties of ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate?
ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate has a molecular weight of 227.21 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6,6-difluoro-5,7-dihydrocyclopenta[b]pyridine-4-carboxylate is sourced from PubChem (CID 171446396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).