C8H8N4O2 — CID 102030693
ethyl tetrazolo[1,5-a]pyridine-8-carboxylate (PubChem CID 102030693) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is ethyl tetrazolo[1,5-a]pyridine-8-carboxylate.
| Compound Name | ethyl tetrazolo[1,5-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 102030693 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | ethyl tetrazolo[1,5-a]pyridine-8-carboxylate |
| SMILES | CCOC(=O)c1cccn2nnnc12 |
| InChI | InChI=1S/C8H8N4O2/c1-2-14-8(13)6-4-3-5-12-7(6)9-10-11-12/h3-5H,2H2,1H3 |
| InChIKey | HJPGXRQWRGMTBM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |