C11H10Cl2N2O2 — CID 59280012
ethyl 2-(dichloromethyl)imidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 59280012) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.12 g/mol. Its IUPAC name is ethyl 2-(dichloromethyl)imidazo[1,2-a]pyridine-8-carboxylate.
| Compound Name | ethyl 2-(dichloromethyl)imidazo[1,2-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 59280012 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | ethyl 2-(dichloromethyl)imidazo[1,2-a]pyridine-8-carboxylate |
| SMILES | CCOC(=O)c1cccn2cc(C(Cl)Cl)nc12 |
| InChI | InChI=1S/C11H10Cl2N2O2/c1-2-17-11(16)7-4-3-5-15-6-8(9(12)13)14-10(7)15/h3-6,9H,2H2,1H3 |
| InChIKey | JHCVREHWAYXGEK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|