C11H11ClN2O2 — CID 19701330
ethyl 8-(chloromethyl)imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 19701330) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is ethyl 8-(chloromethyl)imidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 8-(chloromethyl)imidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19701330 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | ethyl 8-(chloromethyl)imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cn2cccc(CCl)c2n1 |
| InChI | InChI=1S/C11H11ClN2O2/c1-2-16-11(15)9-7-14-5-3-4-8(6-12)10(14)13-9/h3-5,7H,2,6H2,1H3 |
| InChIKey | XSDRGRCKRZUSGQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|