C9H9N3O2 — CID 170452736
ethyl pyrrolo[2,1-c][1,2,4]triazine-3-carboxylate (PubChem CID 170452736) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is ethyl pyrrolo[2,1-c][1,2,4]triazine-3-carboxylate.
| Compound Name | ethyl pyrrolo[2,1-c][1,2,4]triazine-3-carboxylate |
|---|---|
| PubChem CID | 170452736 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | ethyl pyrrolo[2,1-c][1,2,4]triazine-3-carboxylate |
| SMILES | CCOC(=O)c1cn2cccc2nn1 |
| InChI | InChI=1S/C9H9N3O2/c1-2-14-9(13)7-6-12-5-3-4-8(12)11-10-7/h3-6H,2H2,1H3 |
| InChIKey | FLHVAAKVSDEZHN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |