C10H11BN2O4 — CID 167350393
(2-ethoxycarbonylimidazo[1,2-a]pyridin-7-yl)boronic acid (PubChem CID 167350393) has the molecular formula C10H11BN2O4 and a molecular weight of 234.02 g/mol. Its IUPAC name is (2-ethoxycarbonylimidazo[1,2-a]pyridin-7-yl)boronic acid.
| Compound Name | (2-ethoxycarbonylimidazo[1,2-a]pyridin-7-yl)boronic acid |
|---|---|
| PubChem CID | 167350393 |
| Molecular Formula | C10H11BN2O4 |
| Molecular Weight | 234.02 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (2-ethoxycarbonylimidazo[1,2-a]pyridin-7-yl)boronic acid |
| SMILES | CCOC(=O)c1cn2ccc(B(O)O)cc2n1 |
| InChI | InChI=1S/C10H11BN2O4/c1-2-17-10(14)8-6-13-4-3-7(11(15)16)5-9(13)12-8/h3-6,15-16H,2H2,1H3 |
| InChIKey | DYWNUVNLARLJBX-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.02 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|