(2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid

C8H9BN2O2 — CID 142510514

IUPAC(2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid
SMILESCc1cn2ccc(B(O)O)cc2n1
InChIInChI=1S/C8H9BN2O2/c1-6-5-11-3-2-7(9(12)13)4-8(11)10-6/h2-5,12-13H,1H3
InChIKeyYYKDSHVFTQJGFR-UHFFFAOYSA-N
MW175.98 g/mol
LogP-0.68
Rot. Bonds1

About (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid

(2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid (PubChem CID 142510514) has the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. Its IUPAC name is (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid.

Molecular Properties

Compound Name(2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid
PubChem CID142510514
Molecular FormulaC8H9BN2O2
Molecular Weight175.98 g/mol
Exact Mass176.08
IUPAC Name(2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid
SMILESCc1cn2ccc(B(O)O)cc2n1
InChIInChI=1S/C8H9BN2O2/c1-6-5-11-3-2-7(9(12)13)4-8(11)10-6/h2-5,12-13H,1H3
InChIKeyYYKDSHVFTQJGFR-UHFFFAOYSA-N
XLogP-0.68
TPSA57.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.98
LogP ≤ 5-0.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid?
The IUPAC name of (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid (CID 142510514) is (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid.
What is the SMILES notation for (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid?
The canonical SMILES for (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid is Cc1cn2ccc(B(O)O)cc2n1.
What is the InChIKey of (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid?
The InChIKey is YYKDSHVFTQJGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BN2O2/c1-6-5-11-3-2-7(9(12)13)4-8(11)10-6/h2-5,12-13H,1H3.
What are the key properties of (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid?
(2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid has a molecular weight of 175.98 g/mol, XLogP of -0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylimidazo[1,2-a]pyridin-7-yl)boronic acid is sourced from PubChem (CID 142510514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).