[2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid

C8H9BN2O3 — CID 170984913

IUPAC[2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid
SMILESOCc1cn2ccc(B(O)O)cc2n1
InChIInChI=1S/C8H9BN2O3/c12-5-7-4-11-2-1-6(9(13)14)3-8(11)10-7/h1-4,12-14H,5H2
InChIKeyJMYQDCZQSNBFAG-UHFFFAOYSA-N
MW191.98 g/mol
LogP-1.49
Rot. Bonds2

About [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid

[2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid (PubChem CID 170984913) has the molecular formula C8H9BN2O3 and a molecular weight of 191.98 g/mol. Its IUPAC name is [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid.

Molecular Properties

Compound Name[2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid
PubChem CID170984913
Molecular FormulaC8H9BN2O3
Molecular Weight191.98 g/mol
Exact Mass192.07
IUPAC Name[2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid
SMILESOCc1cn2ccc(B(O)O)cc2n1
InChIInChI=1S/C8H9BN2O3/c12-5-7-4-11-2-1-6(9(13)14)3-8(11)10-7/h1-4,12-14H,5H2
InChIKeyJMYQDCZQSNBFAG-UHFFFAOYSA-N
XLogP-1.49
TPSA77.99 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.98
LogP ≤ 5-1.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid?
The IUPAC name of [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid (CID 170984913) is [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid.
What is the SMILES notation for [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid?
The canonical SMILES for [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid is OCc1cn2ccc(B(O)O)cc2n1.
What is the InChIKey of [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid?
The InChIKey is JMYQDCZQSNBFAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BN2O3/c12-5-7-4-11-2-1-6(9(13)14)3-8(11)10-7/h1-4,12-14H,5H2.
What are the key properties of [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid?
[2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid has a molecular weight of 191.98 g/mol, XLogP of -1.49, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)imidazo[1,2-a]pyridin-7-yl]boronic acid is sourced from PubChem (CID 170984913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).