C10H11ClN2O — CID 123431873
7-chloro-2-(ethoxymethyl)imidazo[1,2-a]pyridine (PubChem CID 123431873) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is 7-chloro-2-(ethoxymethyl)imidazo[1,2-a]pyridine.
| Compound Name | 7-chloro-2-(ethoxymethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 123431873 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 7-chloro-2-(ethoxymethyl)imidazo[1,2-a]pyridine |
| SMILES | CCOCc1cn2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C10H11ClN2O/c1-2-14-7-9-6-13-4-3-8(11)5-10(13)12-9/h3-6H,2,7H2,1H3 |
| InChIKey | QKRGTHFNYBHIHW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |