C9H8ClN3S — CID 82343240
2-(7-chloroimidazo[1,2-a]pyridin-2-yl)ethanethioamide (PubChem CID 82343240) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is 2-(7-chloroimidazo[1,2-a]pyridin-2-yl)ethanethioamide.
| Compound Name | 2-(7-chloroimidazo[1,2-a]pyridin-2-yl)ethanethioamide |
|---|---|
| PubChem CID | 82343240 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 2-(7-chloroimidazo[1,2-a]pyridin-2-yl)ethanethioamide |
| SMILES | NC(=S)Cc1cn2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C9H8ClN3S/c10-6-1-2-13-5-7(4-8(11)14)12-9(13)3-6/h1-3,5H,4H2,(H2,11,14) |
| InChIKey | BPDDPSJDPAGCSM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|