C9H9BrN4O — CID 82529989
2-(7-bromoimidazo[1,2-a]pyridin-2-yl)acetohydrazide (PubChem CID 82529989) has the molecular formula C9H9BrN4O and a molecular weight of 269.10 g/mol. Its IUPAC name is 2-(7-bromoimidazo[1,2-a]pyridin-2-yl)acetohydrazide.
| Compound Name | 2-(7-bromoimidazo[1,2-a]pyridin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 82529989 |
| Molecular Formula | C9H9BrN4O |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 2-(7-bromoimidazo[1,2-a]pyridin-2-yl)acetohydrazide |
| SMILES | NNC(=O)Cc1cn2ccc(Br)cc2n1 |
| InChI | InChI=1S/C9H9BrN4O/c10-6-1-2-14-5-7(4-9(15)13-11)12-8(14)3-6/h1-3,5H,4,11H2,(H,13,15) |
| InChIKey | ACXPLJYHANIJBB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|