C10H11ClN4O — CID 82530675
2-(8-chloro-6-methylimidazo[1,2-a]pyridin-2-yl)acetohydrazide (PubChem CID 82530675) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is 2-(8-chloro-6-methylimidazo[1,2-a]pyridin-2-yl)acetohydrazide.
| Compound Name | 2-(8-chloro-6-methylimidazo[1,2-a]pyridin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 82530675 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(8-chloro-6-methylimidazo[1,2-a]pyridin-2-yl)acetohydrazide |
| SMILES | Cc1cc(Cl)c2nc(CC(=O)NN)cn2c1 |
| InChI | InChI=1S/C10H11ClN4O/c1-6-2-8(11)10-13-7(3-9(16)14-12)5-15(10)4-6/h2,4-5H,3,12H2,1H3,(H,14,16) |
| InChIKey | ZRDVAXNAVVWNLV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|