C16H15Cl2N5O — CID 167860410
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)acetamide (PubChem CID 167860410) has the molecular formula C16H15Cl2N5O and a molecular weight of 364.24 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)acetamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)acetamide |
|---|---|
| PubChem CID | 167860410 |
| Molecular Formula | C16H15Cl2N5O |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)acetamide |
| SMILES | C#CCCC1(CCNC(=O)Cc2cn3cc(Cl)cc(Cl)c3n2)N=N1 |
| InChI | InChI=1S/C16H15Cl2N5O/c1-2-3-4-16(21-22-16)5-6-19-14(24)8-12-10-23-9-11(17)7-13(18)15(23)20-12/h1,7,9-10H,3-6,8H2,(H,19,24) |
| InChIKey | SIVGLIUYIYXYRX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|