C9H6ClF3N4O — CID 2725939
8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbohydrazide (PubChem CID 2725939) has the molecular formula C9H6ClF3N4O and a molecular weight of 278.62 g/mol. Its IUPAC name is 8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbohydrazide.
| Compound Name | 8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 2725939 |
| Molecular Formula | C9H6ClF3N4O |
| Molecular Weight | 278.62 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1cn2cc(C(F)(F)F)cc(Cl)c2n1 |
| InChI | InChI=1S/C9H6ClF3N4O/c10-5-1-4(9(11,12)13)2-17-3-6(8(18)16-14)15-7(5)17/h1-3H,14H2,(H,16,18) |
| InChIKey | JKCCTTSRDAUJTG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.62 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|