C10H7ClF3N3S — CID 82530667
2-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethanethioamide (PubChem CID 82530667) has the molecular formula C10H7ClF3N3S and a molecular weight of 293.70 g/mol. Its IUPAC name is 2-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethanethioamide.
| Compound Name | 2-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethanethioamide |
|---|---|
| PubChem CID | 82530667 |
| Molecular Formula | C10H7ClF3N3S |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 2-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethanethioamide |
| SMILES | NC(=S)Cc1cn2cc(C(F)(F)F)cc(Cl)c2n1 |
| InChI | InChI=1S/C10H7ClF3N3S/c11-7-1-5(10(12,13)14)3-17-4-6(2-8(15)18)16-9(7)17/h1,3-4H,2H2,(H2,15,18) |
| InChIKey | WHQVBAFVKGYQOR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|