C23H25ClF3N5O — CID 2796284
N-[3-(4-benzylpiperazin-1-yl)propyl]-8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 2796284) has the molecular formula C23H25ClF3N5O and a molecular weight of 479.93 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 2796284 |
| Molecular Formula | C23H25ClF3N5O |
| Molecular Weight | 479.93 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(NCCCN1CCN(Cc2ccccc2)CC1)c1cn2cc(C(F)(F)F)cc(Cl)c2n1 |
| InChI | InChI=1S/C23H25ClF3N5O/c24-19-13-18(23(25,26)27)15-32-16-20(29-21(19)32)22(33)28-7-4-8-30-9-11-31(12-10-30)14-17-5-2-1-3-6-17/h1-3,5-6,13,15-16H,4,7-12,14H2,(H,28,33) |
| InChIKey | LQJQYHVGMQGFDO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.93 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|