C14H12ClN3 — CID 82343156
[4-(7-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]methanamine (PubChem CID 82343156) has the molecular formula C14H12ClN3 and a molecular weight of 257.72 g/mol. Its IUPAC name is [4-(7-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]methanamine.
| Compound Name | [4-(7-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 82343156 |
| Molecular Formula | C14H12ClN3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | [4-(7-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]methanamine |
| SMILES | NCc1ccc(-c2cn3ccc(Cl)cc3n2)cc1 |
| InChI | InChI=1S/C14H12ClN3/c15-12-5-6-18-9-13(17-14(18)7-12)11-3-1-10(8-16)2-4-11/h1-7,9H,8,16H2 |
| InChIKey | YANSLHAQPIGIOW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |