C9H12N4 — CID 117256321
2-(methylaminomethyl)imidazo[1,2-a]pyridin-7-amine (PubChem CID 117256321) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-(methylaminomethyl)imidazo[1,2-a]pyridin-7-amine.
| Compound Name | 2-(methylaminomethyl)imidazo[1,2-a]pyridin-7-amine |
|---|---|
| PubChem CID | 117256321 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-(methylaminomethyl)imidazo[1,2-a]pyridin-7-amine |
| SMILES | CNCc1cn2ccc(N)cc2n1 |
| InChI | InChI=1S/C9H12N4/c1-11-5-8-6-13-3-2-7(10)4-9(13)12-8/h2-4,6,11H,5,10H2,1H3 |
| InChIKey | JEZABPNEODSGKZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |