About 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine
1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine (PubChem CID 84651376) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine.
Analyze 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine?
The IUPAC name of 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine (CID 84651376) is 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine.
What is the SMILES notation for 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine?
The canonical SMILES for 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine is CNCc1cn2cnccc2n1.
What is the InChIKey of 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine?
The InChIKey is UWQOGWZUPVOHKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-9-4-7-5-12-6-10-3-2-8(12)11-7/h2-3,5-6,9H,4H2,1H3.
What are the key properties of 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine?
1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine has a molecular weight of 162.20 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazo[1,2-c]pyrimidin-2-yl-N-methylmethanamine is sourced from PubChem (CID 84651376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).