C8H9N3O — CID 19735708
2-imidazo[1,2-c]pyrimidin-2-ylethanol (PubChem CID 19735708) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-imidazo[1,2-c]pyrimidin-2-ylethanol.
| Compound Name | 2-imidazo[1,2-c]pyrimidin-2-ylethanol |
|---|---|
| PubChem CID | 19735708 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-imidazo[1,2-c]pyrimidin-2-ylethanol |
| SMILES | OCCc1cn2cnccc2n1 |
| InChI | InChI=1S/C8H9N3O/c12-4-2-7-5-11-6-9-3-1-8(11)10-7/h1,3,5-6,12H,2,4H2 |
| InChIKey | RBNMMVRIJBZIRQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |