C18H17N3O3 — CID 110704737
ethyl 2-[(2-methylimidazo[1,2-a]pyridine-8-carbonyl)amino]benzoate (PubChem CID 110704737) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is ethyl 2-[(2-methylimidazo[1,2-a]pyridine-8-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-[(2-methylimidazo[1,2-a]pyridine-8-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110704737 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | ethyl 2-[(2-methylimidazo[1,2-a]pyridine-8-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cccn2cc(C)nc12 |
| InChI | InChI=1S/C18H17N3O3/c1-3-24-18(23)13-7-4-5-9-15(13)20-17(22)14-8-6-10-21-11-12(2)19-16(14)21/h4-11H,3H2,1-2H3,(H,20,22) |
| InChIKey | AHXVXTOVWUFWIJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |