C10H9IN2O2 — CID 59588379
ethyl 3-iodoimidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 59588379) has the molecular formula C10H9IN2O2 and a molecular weight of 316.10 g/mol. Its IUPAC name is ethyl 3-iodoimidazo[1,2-a]pyridine-8-carboxylate.
| Compound Name | ethyl 3-iodoimidazo[1,2-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 59588379 |
| Molecular Formula | C10H9IN2O2 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | ethyl 3-iodoimidazo[1,2-a]pyridine-8-carboxylate |
| SMILES | CCOC(=O)c1cccn2c(I)cnc12 |
| InChI | InChI=1S/C10H9IN2O2/c1-2-15-10(14)7-4-3-5-13-8(11)6-12-9(7)13/h3-6H,2H2,1H3 |
| InChIKey | SSKJSMLBIMXBKQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|