C10H11ClN2O6S — CID 91757252
ethyl 8-chloroimidazo[1,2-a]pyridine-3-carboxylate;sulfuric acid (PubChem CID 91757252) has the molecular formula C10H11ClN2O6S and a molecular weight of 322.73 g/mol. Its IUPAC name is ethyl 8-chloroimidazo[1,2-a]pyridine-3-carboxylate;sulfuric acid.
| Compound Name | ethyl 8-chloroimidazo[1,2-a]pyridine-3-carboxylate;sulfuric acid |
|---|---|
| PubChem CID | 91757252 |
| Molecular Formula | C10H11ClN2O6S |
| Molecular Weight | 322.73 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | ethyl 8-chloroimidazo[1,2-a]pyridine-3-carboxylate;sulfuric acid |
| SMILES | CCOC(=O)c1cnc2c(Cl)cccn12.O=S(=O)(O)O |
| InChI | InChI=1S/C10H9ClN2O2.H2O4S/c1-2-15-10(14)8-6-12-9-7(11)4-3-5-13(8)9;1-5(2,3)4/h3-6H,2H2,1H3;(H2,1,2,3,4) |
| InChIKey | JMNLOONCBXQRHA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.73 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|