C9H9N3O2 — CID 131336795
methyl 8-aminoimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 131336795) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl 8-aminoimidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | methyl 8-aminoimidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 131336795 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | methyl 8-aminoimidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc2c(N)cccn12 |
| InChI | InChI=1S/C9H9N3O2/c1-14-9(13)7-5-11-8-6(10)3-2-4-12(7)8/h2-5H,10H2,1H3 |
| InChIKey | UAACSHAZHBJILV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |