C14H13N3O5 — CID 13290788
dimethyl 1-(2-aminobenzoyl)pyrazole-3,5-dicarboxylate (PubChem CID 13290788) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is dimethyl 1-(2-aminobenzoyl)pyrazole-3,5-dicarboxylate.
| Compound Name | dimethyl 1-(2-aminobenzoyl)pyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 13290788 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | dimethyl 1-(2-aminobenzoyl)pyrazole-3,5-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)n(C(=O)c2ccccc2N)n1 |
| InChI | InChI=1S/C14H13N3O5/c1-21-13(19)10-7-11(14(20)22-2)17(16-10)12(18)8-5-3-4-6-9(8)15/h3-7H,15H2,1-2H3 |
| InChIKey | YSVXXWODWYAMGT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|