C7H9N3O4 — CID 163321502
dimethyl 5-aminopyrazole-1,3-dicarboxylate (PubChem CID 163321502) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is dimethyl 5-aminopyrazole-1,3-dicarboxylate.
| Compound Name | dimethyl 5-aminopyrazole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 163321502 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | dimethyl 5-aminopyrazole-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(N)n(C(=O)OC)n1 |
| InChI | InChI=1S/C7H9N3O4/c1-13-6(11)4-3-5(8)10(9-4)7(12)14-2/h3H,8H2,1-2H3 |
| InChIKey | BLADCLSOTRSKDZ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |