C4H6N4O2 — CID 23262594
methyl 5-amino-1,2,4-triazole-1-carboxylate (PubChem CID 23262594) has the molecular formula C4H6N4O2 and a molecular weight of 142.12 g/mol. Its IUPAC name is methyl 5-amino-1,2,4-triazole-1-carboxylate.
| Compound Name | methyl 5-amino-1,2,4-triazole-1-carboxylate |
|---|---|
| PubChem CID | 23262594 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | methyl 5-amino-1,2,4-triazole-1-carboxylate |
| SMILES | COC(=O)n1ncnc1N |
| InChI | InChI=1S/C4H6N4O2/c1-10-4(9)8-3(5)6-2-7-8/h2H,1H3,(H2,5,6,7) |
| InChIKey | HOKHLANVBBUNIS-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |