C5H12N4 — CID 167473762
ethane;2-methyl-1,2,4-triazol-3-amine (PubChem CID 167473762) has the molecular formula C5H12N4 and a molecular weight of 128.18 g/mol. Its IUPAC name is ethane;2-methyl-1,2,4-triazol-3-amine.
| Compound Name | ethane;2-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 167473762 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | ethane;2-methyl-1,2,4-triazol-3-amine |
| SMILES | CC.Cn1ncnc1N |
| InChI | InChI=1S/C3H6N4.C2H6/c1-7-3(4)5-2-6-7;1-2/h2H,1H3,(H2,4,5,6);1-2H3 |
| InChIKey | AGZVRKSSTLOORU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |