C9H9FN4 — CID 62696052
4-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)aniline (PubChem CID 62696052) has the molecular formula C9H9FN4 and a molecular weight of 192.20 g/mol. Its IUPAC name is 4-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 4-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 62696052 |
| Molecular Formula | C9H9FN4 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 4-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)aniline |
| SMILES | Cn1ncnc1-c1cc(N)ccc1F |
| InChI | InChI=1S/C9H9FN4/c1-14-9(12-5-13-14)7-4-6(11)2-3-8(7)10/h2-5H,11H2,1H3 |
| InChIKey | LAKQNXNCMWKBKV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|