C10H8FN3O — CID 58542031
5-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)benzaldehyde (PubChem CID 58542031) has the molecular formula C10H8FN3O and a molecular weight of 205.19 g/mol. Its IUPAC name is 5-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)benzaldehyde.
| Compound Name | 5-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 58542031 |
| Molecular Formula | C10H8FN3O |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)benzaldehyde |
| SMILES | Cn1ncnc1-c1ccc(F)cc1C=O |
| InChI | InChI=1S/C10H8FN3O/c1-14-10(12-6-13-14)9-3-2-8(11)4-7(9)5-15/h2-6H,1H3 |
| InChIKey | KVCWMQJYSHUCCY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|