C6H12N4 — CID 45490077
1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine (PubChem CID 45490077) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine.
| Compound Name | 1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 45490077 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine |
| SMILES | CCC(N)c1ncnn1C |
| InChI | InChI=1S/C6H12N4/c1-3-5(7)6-8-4-9-10(6)2/h4-5H,3,7H2,1-2H3 |
| InChIKey | SGXWUDGJVDSLSF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |